4,5,6,7-Tetrahydrothieno[3,2-]pyridine - Names and Identifiers
Name | 4,5,6,7-tetrahydrothieno[3,2-c]pyridine
|
Synonyms | PCR-0665 4,5,6,7-hexahydrothieno[3,2-c]pyridine 4,5,6,7-Tetrahydrothieno[3,2-]pyridine 4,5,6,7-Tetrahydrothieno[3,2-c]pyridine 4,5,6,7-TETRAHYDROTHIENO[3,2-C]PYRIDINE 4,5,6,7-tetrahydrothieno[3,2-c]pyridine Thieno[3,2-c]pyridine, 4,5,6,7-tetrahydro- 4,5,6,7-Tetrahydro-1H-thieno[3,2-c]pyridine
|
CAS | 54903-50-3
|
EINECS | 259-389-2 |
InChI | InChI=1/C7H9NS/c1-3-8-5-6-2-4-9-7(1)6/h2,4,8H,1,3,5H2 |
4,5,6,7-Tetrahydrothieno[3,2-]pyridine - Physico-chemical Properties
Molecular Formula | C7H9NS
|
Molar Mass | 139.22 |
Density | 1.143±0.06 g/cm3(Predicted) |
Boling Point | 75°C/0.5mmHg(lit.) |
Appearance | clear liquid |
Color | Colorless to Light yellow to Light orange |
pKa | 9.36±0.20(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
Refractive Index | 1.5870 to 1.5910 |
4,5,6,7-Tetrahydrothieno[3,2-]pyridine - Risk and Safety
Hazard Symbols | Xi - Irritant
|
4,5,6,7-Tetrahydrothieno[3,2-]pyridine - Introduction
4,5,6,7-tetrahydrothieno[3,2-c]pyridine(4,5,6,7-tetrahydrothieno[3,2-c]pyridine) is an organic compound with the following properties:
1. Appearance: colorless to yellowish solid.
2. Solubility: Soluble in organic solvents, such as ethanol, dimethylformamide and chloroform.
3. melting point: about 92-94 ℃.
4. Boiling point: about 318-319 ℃.
5. Molecular formula: C7H9NS.
6. Molecular weight: 139.22g/mol.
This compound has the following main uses:
1. Intermediate: It is widely used as an intermediate for the synthesis of other organic compounds, such as the synthesis of drugs and pesticides.
2. Drug research: 4,5,6,7-tetrahydrothieno[3,2-c]pyridine and its derivatives play an important role in drug research, such as anti-tumor and anticoagulant.
Common methods for preparing 4,5,6,7-tetrahydrothieno[3,2-c]pyridine include:
1. Deoxyhydrogenation: the corresponding chloropyridine is reacted with tetrahydrothiophene in the presence of hydrogen, and the target product is obtained after heating.
2. Ring Cracking of Epoxy Compounds: The target product is generated by reacting butylene oxide with pyridine under alkaline conditions.
Regarding safety information, you need to pay attention to the following:
1. 4,5,6,7-tetrahydrothieno[3,2-c]pyridine may be irritating to the eyes, skin and respiratory tract, and protective measures should be taken when using it.
2. in use and storage, should be away from the fire and high temperature environment.
3. use should wear appropriate personal protective equipment, such as protective glasses, gloves and protective clothing.
4. Ensure good ventilation conditions when operating this compound and avoid inhaling its gas or dust.
5. in case of accidental exposure or contact, please seek medical attention immediately.
Last Update:2024-04-09 21:21:28